About 6-trimethylsilyloxy-2,3-dihydroinden-1-one
6-trimethylsilyloxy-2,3-dihydroinden-1-one (PubChem CID 167740000) has the molecular formula C12H16O2Si
and a molecular weight of 220.34 g/mol. Its IUPAC name is 6-trimethylsilyloxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 6-trimethylsilyloxy-2,3-dihydroinden-1-one |
| PubChem CID | 167740000 |
| Molecular Formula | C12H16O2Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 6-trimethylsilyloxy-2,3-dihydroinden-1-one |
| SMILES | C[Si](C)(C)Oc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C12H16O2Si/c1-15(2,3)14-10-6-4-9-5-7-12(13)11(9)8-10/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | VJHPLNCJEHUHMM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-trimethylsilyloxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-trimethylsilyloxy-2,3-dihydroinden-1-one?
The IUPAC name of 6-trimethylsilyloxy-2,3-dihydroinden-1-one (CID 167740000) is 6-trimethylsilyloxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 6-trimethylsilyloxy-2,3-dihydroinden-1-one?
The canonical SMILES for 6-trimethylsilyloxy-2,3-dihydroinden-1-one is C[Si](C)(C)Oc1ccc2c(c1)C(=O)CC2.
What is the InChIKey of 6-trimethylsilyloxy-2,3-dihydroinden-1-one?
The InChIKey is VJHPLNCJEHUHMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2Si/c1-15(2,3)14-10-6-4-9-5-7-12(13)11(9)8-10/h4,6,8H,5,7H2,1-3H3.
What are the key properties of 6-trimethylsilyloxy-2,3-dihydroinden-1-one?
6-trimethylsilyloxy-2,3-dihydroinden-1-one has a molecular weight of 220.34 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-trimethylsilyloxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 167740000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).