C26H37N5O3 — CID 167740387
3-[3-oxo-6-[[4-(3-piperidin-3-ylpropyl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167740387) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 3-[3-oxo-6-[[4-(3-piperidin-3-ylpropyl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[4-(3-piperidin-3-ylpropyl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167740387 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 3-[3-oxo-6-[[4-(3-piperidin-3-ylpropyl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(CCCC5CCCNC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H37N5O3/c32-24-8-7-23(25(33)28-24)31-18-21-15-20(5-6-22(21)26(31)34)17-30-13-11-29(12-14-30)10-2-4-19-3-1-9-27-16-19/h5-6,15,19,23,27H,1-4,7-14,16-18H2,(H,28,32,33) |
| InChIKey | LRIGOZUQFOJADN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|