About tert-butyl 5-hydroxy-3,3-dimethylpentanoate
tert-butyl 5-hydroxy-3,3-dimethylpentanoate (PubChem CID 167741051) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-3,3-dimethylpentanoate.
Molecular Properties
| Compound Name | tert-butyl 5-hydroxy-3,3-dimethylpentanoate |
| PubChem CID | 167741051 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | tert-butyl 5-hydroxy-3,3-dimethylpentanoate |
| SMILES | CC(C)(CCO)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22O3/c1-10(2,3)14-9(13)8-11(4,5)6-7-12/h12H,6-8H2,1-5H3 |
| InChIKey | BNNNIESIUYGXRJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 5-hydroxy-3,3-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-hydroxy-3,3-dimethylpentanoate?
The IUPAC name of tert-butyl 5-hydroxy-3,3-dimethylpentanoate (CID 167741051) is tert-butyl 5-hydroxy-3,3-dimethylpentanoate.
What is the SMILES notation for tert-butyl 5-hydroxy-3,3-dimethylpentanoate?
The canonical SMILES for tert-butyl 5-hydroxy-3,3-dimethylpentanoate is CC(C)(CCO)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 5-hydroxy-3,3-dimethylpentanoate?
The InChIKey is BNNNIESIUYGXRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-10(2,3)14-9(13)8-11(4,5)6-7-12/h12H,6-8H2,1-5H3.
What are the key properties of tert-butyl 5-hydroxy-3,3-dimethylpentanoate?
tert-butyl 5-hydroxy-3,3-dimethylpentanoate has a molecular weight of 202.29 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-hydroxy-3,3-dimethylpentanoate is sourced from PubChem (CID 167741051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).