C23H27N5O5 — CID 167741215
5-[[3-(4-aminopiperidine-1-carbonyl)azetidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167741215) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 5-[[3-(4-aminopiperidine-1-carbonyl)azetidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[3-(4-aminopiperidine-1-carbonyl)azetidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167741215 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 5-[[3-(4-aminopiperidine-1-carbonyl)azetidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1CCN(C(=O)C2CN(Cc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)CC1 |
| InChI | InChI=1S/C23H27N5O5/c24-15-5-7-27(8-6-15)21(31)14-11-26(12-14)10-13-1-2-16-17(9-13)23(33)28(22(16)32)18-3-4-19(29)25-20(18)30/h1-2,9,14-15,18H,3-8,10-12,24H2,(H,25,29,30) |
| InChIKey | UMCXTHUEPZOAGL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|