C17H17F3N4O4 — CID 167741997
4-[[(2-amino-3,3,3-trifluoropropyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167741997) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is 4-[[(2-amino-3,3,3-trifluoropropyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[(2-amino-3,3,3-trifluoropropyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167741997 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[[(2-amino-3,3,3-trifluoropropyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC(CNCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N4O4/c18-17(19,20)11(21)7-22-6-8-2-1-3-9-13(8)16(28)24(15(9)27)10-4-5-12(25)23-14(10)26/h1-3,10-11,22H,4-7,21H2,(H,23,25,26) |
| InChIKey | FIDKBHXFUWTVLB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|