C13H19NO3Si — CID 167742082
6-trimethylsilyloxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (PubChem CID 167742082) has the molecular formula C13H19NO3Si and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-trimethylsilyloxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid.
| Compound Name | 6-trimethylsilyloxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 167742082 |
| Molecular Formula | C13H19NO3Si |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-trimethylsilyloxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| SMILES | C[Si](C)(C)Oc1ccc2c(c1)C(C(=O)O)CCN2 |
| InChI | InChI=1S/C13H19NO3Si/c1-18(2,3)17-9-4-5-12-11(8-9)10(13(15)16)6-7-14-12/h4-5,8,10,14H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | RUCRQLRLROJWRF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|