C27H28N4O4 — CID 167742160
2-(2,6-dioxopiperidin-3-yl)-4-[(spiro[1,3-dihydroindene-2,4'-piperidine]-1-ylamino)methyl]isoindole-1,3-dione (PubChem CID 167742160) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[(spiro[1,3-dihydroindene-2,4'-piperidine]-1-ylamino)methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[(spiro[1,3-dihydroindene-2,4'-piperidine]-1-ylamino)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167742160 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[(spiro[1,3-dihydroindene-2,4'-piperidine]-1-ylamino)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC4c5ccccc5CC45CCNCC5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H28N4O4/c32-21-9-8-20(24(33)30-21)31-25(34)19-7-3-5-17(22(19)26(31)35)15-29-23-18-6-2-1-4-16(18)14-27(23)10-12-28-13-11-27/h1-7,20,23,28-29H,8-15H2,(H,30,32,33) |
| InChIKey | AVHAKWYEVYGKEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|