C15H15BClF3N2O2 — CID 167742335
4-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)quinazoline (PubChem CID 167742335) has the molecular formula C15H15BClF3N2O2 and a molecular weight of 358.56 g/mol. Its IUPAC name is 4-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)quinazoline.
| Compound Name | 4-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 167742335 |
| Molecular Formula | C15H15BClF3N2O2 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)quinazoline |
| SMILES | CC1(C)OB(c2ccc3c(Cl)nc(C(F)(F)F)nc3c2)OC1(C)C |
| InChI | InChI=1S/C15H15BClF3N2O2/c1-13(2)14(3,4)24-16(23-13)8-5-6-9-10(7-8)21-12(15(18,19)20)22-11(9)17/h5-7H,1-4H3 |
| InChIKey | XNAGVVOUBSACPD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|