C17H16N4O3 — CID 167743252
7-(2-oxo-1,3,4,5,7,8-hexahydro-1,6-naphthyridine-6-carbonyl)-3H-quinazolin-4-one (PubChem CID 167743252) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 7-(2-oxo-1,3,4,5,7,8-hexahydro-1,6-naphthyridine-6-carbonyl)-3H-quinazolin-4-one.
| Compound Name | 7-(2-oxo-1,3,4,5,7,8-hexahydro-1,6-naphthyridine-6-carbonyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167743252 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 7-(2-oxo-1,3,4,5,7,8-hexahydro-1,6-naphthyridine-6-carbonyl)-3H-quinazolin-4-one |
| SMILES | O=C1CCC2=C(CCN(C(=O)c3ccc4c(=O)[nH]cnc4c3)C2)N1 |
| InChI | InChI=1S/C17H16N4O3/c22-15-4-2-11-8-21(6-5-13(11)20-15)17(24)10-1-3-12-14(7-10)18-9-19-16(12)23/h1,3,7,9H,2,4-6,8H2,(H,20,22)(H,18,19,23) |
| InChIKey | OGEASUCNEVJZGE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |