C17H18N4O — CID 167743849
2-amino-N-(1H-indol-4-yl)-4-pyridin-4-ylbutanamide (PubChem CID 167743849) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-amino-N-(1H-indol-4-yl)-4-pyridin-4-ylbutanamide.
| Compound Name | 2-amino-N-(1H-indol-4-yl)-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 167743849 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-amino-N-(1H-indol-4-yl)-4-pyridin-4-ylbutanamide |
| SMILES | NC(CCc1ccncc1)C(=O)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H18N4O/c18-14(5-4-12-6-9-19-10-7-12)17(22)21-16-3-1-2-15-13(16)8-11-20-15/h1-3,6-11,14,20H,4-5,18H2,(H,21,22) |
| InChIKey | UXSOGNAPXRGBGD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |