C15H17ClF3N3O2 — CID 167744543
2-[[4-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]phenyl]methoxy]ethanol (PubChem CID 167744543) has the molecular formula C15H17ClF3N3O2 and a molecular weight of 363.77 g/mol. Its IUPAC name is 2-[[4-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]phenyl]methoxy]ethanol.
| Compound Name | 2-[[4-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]phenyl]methoxy]ethanol |
|---|---|
| PubChem CID | 167744543 |
| Molecular Formula | C15H17ClF3N3O2 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[[4-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylamino]phenyl]methoxy]ethanol |
| SMILES | Cn1nc(C(F)(F)F)c(CNc2ccc(COCCO)cc2)c1Cl |
| InChI | InChI=1S/C15H17ClF3N3O2/c1-22-14(16)12(13(21-22)15(17,18)19)8-20-11-4-2-10(3-5-11)9-24-7-6-23/h2-5,20,23H,6-9H2,1H3 |
| InChIKey | QQLILAHCFFDUSM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|