C17H19N3O3S2 — CID 167744619
N-(1,2,3,4-tetrahydroquinolin-5-ylsulfonyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 167744619) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroquinolin-5-ylsulfonyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydroquinolin-5-ylsulfonyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 167744619 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(1,2,3,4-tetrahydroquinolin-5-ylsulfonyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccc2c1CCCN2)C1CCCc2scnc21 |
| InChI | InChI=1S/C17H19N3O3S2/c21-17(12-4-1-7-14-16(12)19-10-24-14)20-25(22,23)15-8-2-6-13-11(15)5-3-9-18-13/h2,6,8,10,12,18H,1,3-5,7,9H2,(H,20,21) |
| InChIKey | OPVKMMXLGWPBQX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |