C21H29N3O2 — CID 167745307
1'-(3,3-dimethylbutanoyl)spiro[2,5,6,10b-tetrahydroimidazo[5,1-a]isoquinoline-3,4'-piperidine]-1-one (PubChem CID 167745307) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1'-(3,3-dimethylbutanoyl)spiro[2,5,6,10b-tetrahydroimidazo[5,1-a]isoquinoline-3,4'-piperidine]-1-one.
| Compound Name | 1'-(3,3-dimethylbutanoyl)spiro[2,5,6,10b-tetrahydroimidazo[5,1-a]isoquinoline-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 167745307 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1'-(3,3-dimethylbutanoyl)spiro[2,5,6,10b-tetrahydroimidazo[5,1-a]isoquinoline-3,4'-piperidine]-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC2(CC1)NC(=O)C1c3ccccc3CCN12 |
| InChI | InChI=1S/C21H29N3O2/c1-20(2,3)14-17(25)23-12-9-21(10-13-23)22-19(26)18-16-7-5-4-6-15(16)8-11-24(18)21/h4-7,18H,8-14H2,1-3H3,(H,22,26) |
| InChIKey | AZBIYJXGBLIYGP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |