C19H17N5O — CID 167747035
N-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-2,6-naphthyridin-1-amine (PubChem CID 167747035) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-2,6-naphthyridin-1-amine.
| Compound Name | N-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 167747035 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-2,6-naphthyridin-1-amine |
| SMILES | c1ccc(Cc2noc(CCNc3nccc4cnccc34)n2)cc1 |
| InChI | InChI=1S/C19H17N5O/c1-2-4-14(5-3-1)12-17-23-18(25-24-17)8-11-22-19-16-7-9-20-13-15(16)6-10-21-19/h1-7,9-10,13H,8,11-12H2,(H,21,22) |
| InChIKey | LJCNNFSEGCJSMX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |