C17H12ClF5N2O3 — CID 167747807
N'-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]oxamide (PubChem CID 167747807) has the molecular formula C17H12ClF5N2O3 and a molecular weight of 422.74 g/mol. Its IUPAC name is N'-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]oxamide.
| Compound Name | N'-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 167747807 |
| Molecular Formula | C17H12ClF5N2O3 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N'-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)C(=O)Nc1ccc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H12ClF5N2O3/c18-12-6-11(3-4-14(12)28-8-17(21,22)23)25-16(27)15(26)24-7-9-1-2-10(19)5-13(9)20/h1-6H,7-8H2,(H,24,26)(H,25,27) |
| InChIKey | UTAGQCUOLIUWKY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|