About 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide
2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide (PubChem CID 167747929) has the molecular formula C12H10F3N3O4S
and a molecular weight of 349.29 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 167747929 |
| Molecular Formula | C12H10F3N3O4S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)nc2)c(C)o1 |
| InChI | InChI=1S/C12H10F3N3O4S/c1-6-10(17-7(2)22-6)11(19)18-23(20,21)8-3-4-9(16-5-8)12(13,14)15/h3-5H,1-2H3,(H,18,19) |
| InChIKey | WUJGMKBHMUWATP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide (CID 167747929) is 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide is Cc1nc(C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)nc2)c(C)o1.
What is the InChIKey of 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide?
The InChIKey is WUJGMKBHMUWATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N3O4S/c1-6-10(17-7(2)22-6)11(19)18-23(20,21)8-3-4-9(16-5-8)12(13,14)15/h3-5H,1-2H3,(H,18,19).
What are the key properties of 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide?
2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide has a molecular weight of 349.29 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 167747929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).