C18H27N7O — CID 167749837
1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea (PubChem CID 167749837) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 167749837 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]urea |
| SMILES | CC1(C)CC(NC(=O)NCc2ccc(-n3cncn3)nc2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H27N7O/c1-17(2)7-14(8-18(3,4)24-17)23-16(26)21-10-13-5-6-15(20-9-13)25-12-19-11-22-25/h5-6,9,11-12,14,24H,7-8,10H2,1-4H3,(H2,21,23,26) |
| InChIKey | KPUVWIJPVLPUMW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |