About 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide
3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide (PubChem CID 167749937) has the molecular formula C9H10N4OS
and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide.
Molecular Properties
| Compound Name | 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide |
| PubChem CID | 167749937 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(-c2nccs2)cn1 |
| InChI | InChI=1S/C9H10N4OS/c10-8(14)1-3-13-6-7(5-12-13)9-11-2-4-15-9/h2,4-6H,1,3H2,(H2,10,14) |
| InChIKey | WLEJHXGFURGCLZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide?
The IUPAC name of 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide (CID 167749937) is 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide.
What is the SMILES notation for 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide?
The canonical SMILES for 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide is NC(=O)CCn1cc(-c2nccs2)cn1.
What is the InChIKey of 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide?
The InChIKey is WLEJHXGFURGCLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS/c10-8(14)1-3-13-6-7(5-12-13)9-11-2-4-15-9/h2,4-6H,1,3H2,(H2,10,14).
What are the key properties of 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide?
3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide has a molecular weight of 222.27 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,3-thiazol-2-yl)pyrazol-1-yl]propanamide is sourced from PubChem (CID 167749937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).