About N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide
N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide (PubChem CID 167750163) has the molecular formula C11H21N3O4S2
and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide |
| PubChem CID | 167750163 |
| Molecular Formula | C11H21N3O4S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide |
| SMILES | C=CCCC(=O)N1CCN(S(=O)(=O)N=S(C)(C)=O)CC1 |
| InChI | InChI=1S/C11H21N3O4S2/c1-4-5-6-11(15)13-7-9-14(10-8-13)20(17,18)12-19(2,3)16/h4H,1,5-10H2,2-3H3 |
| InChIKey | MTOXNXNXBQBFGP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide?
The IUPAC name of N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide (CID 167750163) is N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide.
What is the SMILES notation for N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide?
The canonical SMILES for N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide is C=CCCC(=O)N1CCN(S(=O)(=O)N=S(C)(C)=O)CC1.
What is the InChIKey of N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide?
The InChIKey is MTOXNXNXBQBFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O4S2/c1-4-5-6-11(15)13-7-9-14(10-8-13)20(17,18)12-19(2,3)16/h4H,1,5-10H2,2-3H3.
What are the key properties of N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide?
N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide has a molecular weight of 323.44 g/mol, XLogP of 0.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethyl(oxo)-λ6-sulfanylidene]-4-pent-4-enoylpiperazine-1-sulfonamide is sourced from PubChem (CID 167750163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).