About N,3-dimethylbutan-2-amine
N,3-dimethylbutan-2-amine (PubChem CID 16775060) has the molecular formula C6H15N
and a molecular weight of 101.19 g/mol. Its IUPAC name is N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N,3-dimethylbutan-2-amine |
| PubChem CID | 16775060 |
| Molecular Formula | C6H15N |
| Molecular Weight | 101.19 g/mol |
| Exact Mass | 101.12 |
| IUPAC Name | N,3-dimethylbutan-2-amine |
| SMILES | CNC(C)C(C)C |
| InChI | InChI=1S/C6H15N/c1-5(2)6(3)7-4/h5-7H,1-4H3 |
| InChIKey | LJLWVVCWBURGCC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbutan-2-amine?
The IUPAC name of N,3-dimethylbutan-2-amine (CID 16775060) is N,3-dimethylbutan-2-amine.
What is the SMILES notation for N,3-dimethylbutan-2-amine?
The canonical SMILES for N,3-dimethylbutan-2-amine is CNC(C)C(C)C.
What is the InChIKey of N,3-dimethylbutan-2-amine?
The InChIKey is LJLWVVCWBURGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N/c1-5(2)6(3)7-4/h5-7H,1-4H3.
What are the key properties of N,3-dimethylbutan-2-amine?
N,3-dimethylbutan-2-amine has a molecular weight of 101.19 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbutan-2-amine is sourced from PubChem (CID 16775060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).