C18H16BrClN4 — CID 167750941
3-[1-[(2-bromo-5-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 167750941) has the molecular formula C18H16BrClN4 and a molecular weight of 403.71 g/mol. Its IUPAC name is 3-[1-[(2-bromo-5-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[1-[(2-bromo-5-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 167750941 |
| Molecular Formula | C18H16BrClN4 |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 3-[1-[(2-bromo-5-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cnc(Br)c(CN2CC=C(c3c[nH]c4ncccc34)CC2)c1 |
| InChI | InChI=1S/C18H16BrClN4/c19-17-13(8-14(20)9-22-17)11-24-6-3-12(4-7-24)16-10-23-18-15(16)2-1-5-21-18/h1-3,5,8-10H,4,6-7,11H2,(H,21,23) |
| InChIKey | GVKGTINVHZYBHC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|