C20H18BrNO3S — CID 167752546
2-[(3-bromothiophen-2-yl)methylamino]-3-(3-phenoxyphenyl)propanoic acid (PubChem CID 167752546) has the molecular formula C20H18BrNO3S and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methylamino]-3-(3-phenoxyphenyl)propanoic acid.
| Compound Name | 2-[(3-bromothiophen-2-yl)methylamino]-3-(3-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 167752546 |
| Molecular Formula | C20H18BrNO3S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methylamino]-3-(3-phenoxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Oc2ccccc2)c1)NCc1sccc1Br |
| InChI | InChI=1S/C20H18BrNO3S/c21-17-9-10-26-19(17)13-22-18(20(23)24)12-14-5-4-8-16(11-14)25-15-6-2-1-3-7-15/h1-11,18,22H,12-13H2,(H,23,24) |
| InChIKey | PDKFIWHULVZBPK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |