C15H17Cl2FN2O2 — CID 167753113
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]urea (PubChem CID 167753113) has the molecular formula C15H17Cl2FN2O2 and a molecular weight of 347.22 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]urea |
|---|---|
| PubChem CID | 167753113 |
| Molecular Formula | C15H17Cl2FN2O2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]urea |
| SMILES | CC(NC(=O)N[C@@H]1C[C@@H]2CC[C@H]1O2)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2FN2O2/c1-7(9-5-12(18)11(17)6-10(9)16)19-15(21)20-13-4-8-2-3-14(13)22-8/h5-8,13-14H,2-4H2,1H3,(H2,19,20,21)/t7?,8-,13+,14+/m0/s1 |
| InChIKey | YQJLIJYFOHGCBO-FHHDQOFOSA-N |
| XLogP | 3.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|