C21H17N5O2 — CID 167753642
2-N-(4-methylphenyl)-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide (PubChem CID 167753642) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-N-(4-methylphenyl)-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide.
| Compound Name | 2-N-(4-methylphenyl)-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 167753642 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-N-(4-methylphenyl)-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccccc3)n3cnc(C(N)=O)c3n2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c1-13-7-9-15(10-8-13)24-21(28)16-11-17(14-5-3-2-4-6-14)26-12-23-18(19(22)27)20(26)25-16/h2-12H,1H3,(H2,22,27)(H,24,28) |
| InChIKey | ZBZLWJNGXCCLLH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |