C19H23N5O2 — CID 167754259
3-[[(6-methoxyimidazo[1,2-a]pyridin-3-yl)methylamino]methyl]-6-methyl-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one (PubChem CID 167754259) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-[[(6-methoxyimidazo[1,2-a]pyridin-3-yl)methylamino]methyl]-6-methyl-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one.
| Compound Name | 3-[[(6-methoxyimidazo[1,2-a]pyridin-3-yl)methylamino]methyl]-6-methyl-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 167754259 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[[(6-methoxyimidazo[1,2-a]pyridin-3-yl)methylamino]methyl]-6-methyl-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| SMILES | COc1ccc2ncc(CNCc3cc4c([nH]c3=O)CCN(C)C4)n2c1 |
| InChI | InChI=1S/C19H23N5O2/c1-23-6-5-17-14(11-23)7-13(19(25)22-17)8-20-9-15-10-21-18-4-3-16(26-2)12-24(15)18/h3-4,7,10,12,20H,5-6,8-9,11H2,1-2H3,(H,22,25) |
| InChIKey | DJPQWAJRCNZJHY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |