C22H18F3N5 — CID 167754824
N,N-dimethyl-5-[1-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]pyridin-2-amine (PubChem CID 167754824) has the molecular formula C22H18F3N5 and a molecular weight of 409.42 g/mol. Its IUPAC name is N,N-dimethyl-5-[1-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-5-[1-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 167754824 |
| Molecular Formula | C22H18F3N5 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N,N-dimethyl-5-[1-phenyl-5-[(2,4,5-trifluorophenyl)methyl]-1,2,4-triazol-3-yl]pyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2nc(Cc3cc(F)c(F)cc3F)n(-c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C22H18F3N5/c1-29(2)20-9-8-14(13-26-20)22-27-21(30(28-22)16-6-4-3-5-7-16)11-15-10-18(24)19(25)12-17(15)23/h3-10,12-13H,11H2,1-2H3 |
| InChIKey | LDSICZMNUGHOMX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|