About N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine
N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine (PubChem CID 167754956) has the molecular formula C21H26N6
and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine.
Molecular Properties
| Compound Name | N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine |
| PubChem CID | 167754956 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine |
| SMILES | Cc1cc(C)cc(-n2ncc(CNc3cc(N4CCCCC4)ccn3)n2)c1 |
| InChI | InChI=1S/C21H26N6/c1-16-10-17(2)12-20(11-16)27-24-15-18(25-27)14-23-21-13-19(6-7-22-21)26-8-4-3-5-9-26/h6-7,10-13,15H,3-5,8-9,14H2,1-2H3,(H,22,23) |
| InChIKey | HZIQNBQKWOUDEJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine?
The IUPAC name of N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine (CID 167754956) is N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine.
What is the SMILES notation for N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine?
The canonical SMILES for N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine is Cc1cc(C)cc(-n2ncc(CNc3cc(N4CCCCC4)ccn3)n2)c1.
What is the InChIKey of N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine?
The InChIKey is HZIQNBQKWOUDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N6/c1-16-10-17(2)12-20(11-16)27-24-15-18(25-27)14-23-21-13-19(6-7-22-21)26-8-4-3-5-9-26/h6-7,10-13,15H,3-5,8-9,14H2,1-2H3,(H,22,23).
What are the key properties of N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine?
N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine has a molecular weight of 362.48 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3,5-dimethylphenyl)triazol-4-yl]methyl]-4-piperidin-1-ylpyridin-2-amine is sourced from PubChem (CID 167754956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).