3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride

C10H14ClNO4S2 — CID 16775518

IUPAC3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride
SMILESCc1cc(C)c(S(=O)(=O)Cl)c(C)c1NS(C)(=O)=O
InChIInChI=1S/C10H14ClNO4S2/c1-6-5-7(2)10(18(11,15)16)8(3)9(6)12-17(4,13)14/h5,12H,1-4H3
InChIKeyOCJIUIOHHITCBL-UHFFFAOYSA-N
MW311.81 g/mol
LogP1.91
Rot. Bonds3

About 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride

3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 16775518) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride.

Molecular Properties

Compound Name3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride
PubChem CID16775518
Molecular FormulaC10H14ClNO4S2
Molecular Weight311.81 g/mol
Exact Mass311.01
IUPAC Name3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride
SMILESCc1cc(C)c(S(=O)(=O)Cl)c(C)c1NS(C)(=O)=O
InChIInChI=1S/C10H14ClNO4S2/c1-6-5-7(2)10(18(11,15)16)8(3)9(6)12-17(4,13)14/h5,12H,1-4H3
InChIKeyOCJIUIOHHITCBL-UHFFFAOYSA-N
XLogP1.91
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.81
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride (CID 16775518) is 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride.
What is the SMILES notation for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The canonical SMILES for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride is Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1NS(C)(=O)=O.
What is the InChIKey of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The InChIKey is OCJIUIOHHITCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO4S2/c1-6-5-7(2)10(18(11,15)16)8(3)9(6)12-17(4,13)14/h5,12H,1-4H3.
What are the key properties of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride has a molecular weight of 311.81 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride is sourced from PubChem (CID 16775518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).