About 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride
3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 16775518) has the molecular formula C10H14ClNO4S2
and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride |
| PubChem CID | 16775518 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1NS(C)(=O)=O |
| InChI | InChI=1S/C10H14ClNO4S2/c1-6-5-7(2)10(18(11,15)16)8(3)9(6)12-17(4,13)14/h5,12H,1-4H3 |
| InChIKey | OCJIUIOHHITCBL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride (CID 16775518) is 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride.
What is the SMILES notation for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The canonical SMILES for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride is Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1NS(C)(=O)=O.
What is the InChIKey of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
The InChIKey is OCJIUIOHHITCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO4S2/c1-6-5-7(2)10(18(11,15)16)8(3)9(6)12-17(4,13)14/h5,12H,1-4H3.
What are the key properties of 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride?
3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride has a molecular weight of 311.81 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)-2,4,6-trimethylbenzenesulfonyl chloride is sourced from PubChem (CID 16775518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).