C22H27Cl2N7O — CID 167755228
N-[3-[[2-[(3,4-dichlorophenyl)methyl-methylamino]-7-methylpurin-6-yl]amino]propyl]cyclobutanecarboxamide (PubChem CID 167755228) has the molecular formula C22H27Cl2N7O and a molecular weight of 476.41 g/mol. Its IUPAC name is N-[3-[[2-[(3,4-dichlorophenyl)methyl-methylamino]-7-methylpurin-6-yl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[2-[(3,4-dichlorophenyl)methyl-methylamino]-7-methylpurin-6-yl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 167755228 |
| Molecular Formula | C22H27Cl2N7O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[3-[[2-[(3,4-dichlorophenyl)methyl-methylamino]-7-methylpurin-6-yl]amino]propyl]cyclobutanecarboxamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)c1nc(NCCCNC(=O)C2CCC2)c2c(ncn2C)n1 |
| InChI | InChI=1S/C22H27Cl2N7O/c1-30(12-14-7-8-16(23)17(24)11-14)22-28-19(18-20(29-22)27-13-31(18)2)25-9-4-10-26-21(32)15-5-3-6-15/h7-8,11,13,15H,3-6,9-10,12H2,1-2H3,(H,26,32)(H,25,28,29) |
| InChIKey | LUQTXNBVQXITSJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|