C20H29N3O6S — CID 167755342
trans-(1R,2R)-N-[4-[(2-cyclopent-2-en-1-ylacetyl)amino]-9-oxo-1-oxa-9λ6-thiaspiro[5.5]undecan-9-ylidene]-2-nitrocyclopropane-1-carboxamide (PubChem CID 167755342) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is trans-(1R,2R)-N-[4-[(2-cyclopent-2-en-1-ylacetyl)amino]-9-oxo-1-oxa-9λ6-thiaspiro[5.5]undecan-9-ylidene]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[4-[(2-cyclopent-2-en-1-ylacetyl)amino]-9-oxo-1-oxa-9λ6-thiaspiro[5.5]undecan-9-ylidene]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167755342 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | trans-(1R,2R)-N-[4-[(2-cyclopent-2-en-1-ylacetyl)amino]-9-oxo-1-oxa-9λ6-thiaspiro[5.5]undecan-9-ylidene]-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(CC1C=CCC1)NC1CCOC2(CCS(=O)(=NC(=O)[C@@H]3C[C@H]3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C20H29N3O6S/c24-18(11-14-3-1-2-4-14)21-15-5-8-29-20(13-15)6-9-30(28,10-7-20)22-19(25)16-12-17(16)23(26)27/h1,3,14-17H,2,4-13H2,(H,21,24)/t14?,15?,16-,17-,20?,30?/m1/s1 |
| InChIKey | PQAWOHVXIGNYBD-CTABQGFRSA-N |
| XLogP | 1.83 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|