C17H17N5O2S — CID 167755754
N-[5-[4-(oxolan-3-yl)anilino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]acetamide (PubChem CID 167755754) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[5-[4-(oxolan-3-yl)anilino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]acetamide.
| Compound Name | N-[5-[4-(oxolan-3-yl)anilino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 167755754 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[5-[4-(oxolan-3-yl)anilino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2cnc(Nc3ccc(C4CCOC4)cc3)nc2s1 |
| InChI | InChI=1S/C17H17N5O2S/c1-10(23)19-17-21-14-8-18-16(22-15(14)25-17)20-13-4-2-11(3-5-13)12-6-7-24-9-12/h2-5,8,12H,6-7,9H2,1H3,(H,18,20,22)(H,19,21,23) |
| InChIKey | ZFLSNHPHFMBPAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |