C16H25ClN2O2S — CID 167755961
2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-N-(2,2,6,6-tetramethyloxan-4-yl)acetamide (PubChem CID 167755961) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-N-(2,2,6,6-tetramethyloxan-4-yl)acetamide.
| Compound Name | 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-N-(2,2,6,6-tetramethyloxan-4-yl)acetamide |
|---|---|
| PubChem CID | 167755961 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-N-(2,2,6,6-tetramethyloxan-4-yl)acetamide |
| SMILES | Cc1cnc(CN(C(=O)CCl)C2CC(C)(C)OC(C)(C)C2)s1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-11-9-18-13(22-11)10-19(14(20)8-17)12-6-15(2,3)21-16(4,5)7-12/h9,12H,6-8,10H2,1-5H3 |
| InChIKey | CQMAVGYTWCGSQS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|