About 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one
5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one (PubChem CID 167756272) has the molecular formula C9H10ClF3N2O
and a molecular weight of 254.64 g/mol. Its IUPAC name is 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one |
| PubChem CID | 167756272 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one |
| SMILES | CC(Cn1cncc(Cl)c1=O)CC(F)(F)F |
| InChI | InChI=1S/C9H10ClF3N2O/c1-6(2-9(11,12)13)4-15-5-14-3-7(10)8(15)16/h3,5-6H,2,4H2,1H3 |
| InChIKey | SMTAEYUGVHCVPV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one?
The IUPAC name of 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one (CID 167756272) is 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one.
What is the SMILES notation for 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one?
The canonical SMILES for 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one is CC(Cn1cncc(Cl)c1=O)CC(F)(F)F.
What is the InChIKey of 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one?
The InChIKey is SMTAEYUGVHCVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF3N2O/c1-6(2-9(11,12)13)4-15-5-14-3-7(10)8(15)16/h3,5-6H,2,4H2,1H3.
What are the key properties of 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one?
5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one has a molecular weight of 254.64 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(4,4,4-trifluoro-2-methylbutyl)pyrimidin-4-one is sourced from PubChem (CID 167756272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).