About 3-(diethylamino)-N'-hydroxypropanimidamide
3-(diethylamino)-N'-hydroxypropanimidamide (PubChem CID 16775726) has the molecular formula C7H17N3O
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(diethylamino)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-(diethylamino)-N'-hydroxypropanimidamide |
| PubChem CID | 16775726 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 3-(diethylamino)-N'-hydroxypropanimidamide |
| SMILES | CCN(CC)CC/C(N)=N/O |
| InChI | InChI=1S/C7H17N3O/c1-3-10(4-2)6-5-7(8)9-11/h11H,3-6H2,1-2H3,(H2,8,9) |
| InChIKey | OSZIZRKFGYQTMJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethylamino)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)-N'-hydroxypropanimidamide?
The IUPAC name of 3-(diethylamino)-N'-hydroxypropanimidamide (CID 16775726) is 3-(diethylamino)-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-(diethylamino)-N'-hydroxypropanimidamide?
The canonical SMILES for 3-(diethylamino)-N'-hydroxypropanimidamide is CCN(CC)CC/C(N)=N/O.
What is the InChIKey of 3-(diethylamino)-N'-hydroxypropanimidamide?
The InChIKey is OSZIZRKFGYQTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3O/c1-3-10(4-2)6-5-7(8)9-11/h11H,3-6H2,1-2H3,(H2,8,9).
What are the key properties of 3-(diethylamino)-N'-hydroxypropanimidamide?
3-(diethylamino)-N'-hydroxypropanimidamide has a molecular weight of 159.23 g/mol, XLogP of 0.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)-N'-hydroxypropanimidamide is sourced from PubChem (CID 16775726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).