About 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane
1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane (PubChem CID 167757747) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane.
Molecular Properties
| Compound Name | 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane |
| PubChem CID | 167757747 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane |
| SMILES | CC(Oc1ccc2ccccc2c1)c1nnc(N2CCCCCC2)n1C |
| InChI | InChI=1S/C21H26N4O/c1-16(26-19-12-11-17-9-5-6-10-18(17)15-19)20-22-23-21(24(20)2)25-13-7-3-4-8-14-25/h5-6,9-12,15-16H,3-4,7-8,13-14H2,1-2H3 |
| InChIKey | PPWJUHZPUGFEPT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane?
The IUPAC name of 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane (CID 167757747) is 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane.
What is the SMILES notation for 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane?
The canonical SMILES for 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane is CC(Oc1ccc2ccccc2c1)c1nnc(N2CCCCCC2)n1C.
What is the InChIKey of 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane?
The InChIKey is PPWJUHZPUGFEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c1-16(26-19-12-11-17-9-5-6-10-18(17)15-19)20-22-23-21(24(20)2)25-13-7-3-4-8-14-25/h5-6,9-12,15-16H,3-4,7-8,13-14H2,1-2H3.
What are the key properties of 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane?
1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane has a molecular weight of 350.47 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-methyl-5-(1-naphthalen-2-yloxyethyl)-1,2,4-triazol-3-yl]azepane is sourced from PubChem (CID 167757747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).