C11H9Cl2N3O2 — CID 16775776
N-(4-amino-2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 16775776) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 16775776 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-5-7(4-15-18-5)11(17)16-10-8(12)2-6(14)3-9(10)13/h2-4H,14H2,1H3,(H,16,17) |
| InChIKey | WLOWCAYTPPGWEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|