C17H21N3O3 — CID 167758505
2-(methoxymethyl)-1-[(3-methylquinoxalin-2-yl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 167758505) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(methoxymethyl)-1-[(3-methylquinoxalin-2-yl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-(methoxymethyl)-1-[(3-methylquinoxalin-2-yl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167758505 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(methoxymethyl)-1-[(3-methylquinoxalin-2-yl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COCC1(C(=O)O)CCCN1Cc1nc2ccccc2nc1C |
| InChI | InChI=1S/C17H21N3O3/c1-12-15(19-14-7-4-3-6-13(14)18-12)10-20-9-5-8-17(20,11-23-2)16(21)22/h3-4,6-7H,5,8-11H2,1-2H3,(H,21,22) |
| InChIKey | HGYBTQZGRQNDBZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |