C17H25N5O3 — CID 167759058
N-[2-(2-methylcyclohexyl)oxyethyl]-2-[4-(3-methyl-1,2-oxazol-5-yl)triazol-1-yl]acetamide (PubChem CID 167759058) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(2-methylcyclohexyl)oxyethyl]-2-[4-(3-methyl-1,2-oxazol-5-yl)triazol-1-yl]acetamide.
| Compound Name | N-[2-(2-methylcyclohexyl)oxyethyl]-2-[4-(3-methyl-1,2-oxazol-5-yl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 167759058 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-(2-methylcyclohexyl)oxyethyl]-2-[4-(3-methyl-1,2-oxazol-5-yl)triazol-1-yl]acetamide |
| SMILES | Cc1cc(-c2cn(CC(=O)NCCOC3CCCCC3C)nn2)on1 |
| InChI | InChI=1S/C17H25N5O3/c1-12-5-3-4-6-15(12)24-8-7-18-17(23)11-22-10-14(19-21-22)16-9-13(2)20-25-16/h9-10,12,15H,3-8,11H2,1-2H3,(H,18,23) |
| InChIKey | YRJNYMSOVJGEEA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|