C11H14N4O3 — CID 167759417
N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide (PubChem CID 167759417) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 167759417 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-[[(1S,2R,4S,5S,6S)-8-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl]-5-oxo-1,4-dihydro-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC[C@@H]1C[C@@H]2O[C@H]1[C@H]1C[C@H]12)c1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N4O3/c16-10(9-13-11(17)15-14-9)12-3-4-1-7-5-2-6(5)8(4)18-7/h4-8H,1-3H2,(H,12,16)(H2,13,14,15,17)/t4-,5+,6-,7-,8+/m0/s1 |
| InChIKey | NDEASBPRWOFATL-GWVFRZDISA-N |
| XLogP | -0.75 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |