C18H25F3N2O2S — CID 167759982
N-(thiophen-3-ylmethyl)-N-[6-[2-(2,2,2-trifluoroethoxy)ethyl]-6-azaspiro[2.5]octan-2-yl]acetamide (PubChem CID 167759982) has the molecular formula C18H25F3N2O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-N-[6-[2-(2,2,2-trifluoroethoxy)ethyl]-6-azaspiro[2.5]octan-2-yl]acetamide.
| Compound Name | N-(thiophen-3-ylmethyl)-N-[6-[2-(2,2,2-trifluoroethoxy)ethyl]-6-azaspiro[2.5]octan-2-yl]acetamide |
|---|---|
| PubChem CID | 167759982 |
| Molecular Formula | C18H25F3N2O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-N-[6-[2-(2,2,2-trifluoroethoxy)ethyl]-6-azaspiro[2.5]octan-2-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccsc1)C1CC12CCN(CCOCC(F)(F)F)CC2 |
| InChI | InChI=1S/C18H25F3N2O2S/c1-14(24)23(11-15-2-9-26-12-15)16-10-17(16)3-5-22(6-4-17)7-8-25-13-18(19,20)21/h2,9,12,16H,3-8,10-11,13H2,1H3 |
| InChIKey | PWGXCWIYIJSBRD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|