C28H30F3N7O4 — CID 167760317
5-[[[6-methyl-4-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]amino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 167760317) has the molecular formula C28H30F3N7O4 and a molecular weight of 585.59 g/mol. Its IUPAC name is 5-[[[6-methyl-4-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]amino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[[6-methyl-4-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]amino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167760317 |
| Molecular Formula | C28H30F3N7O4 |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 5-[[[6-methyl-4-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]amino]methyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCc2nc(NCc3cc(C(N)=O)co3)nc(NCc3cccc(-c4cnn(C)c4)c3)c2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29N7O2.C2HF3O2/c1-16-6-7-23-22(8-16)25(32-26(31-23)29-13-21-10-19(15-35-21)24(27)34)28-11-17-4-3-5-18(9-17)20-12-30-33(2)14-20;3-2(4,5)1(6)7/h3-5,9-10,12,14-16H,6-8,11,13H2,1-2H3,(H2,27,34)(H2,28,29,31,32);(H,6,7) |
| InChIKey | UQHJIHFAMCGIDN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 161.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |