C18H19Cl2FN2 — CID 167760406
1-(2,6-dichlorophenyl)-4-[2-(3-fluorophenyl)ethyl]piperazine (PubChem CID 167760406) has the molecular formula C18H19Cl2FN2 and a molecular weight of 353.27 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4-[2-(3-fluorophenyl)ethyl]piperazine.
| Compound Name | 1-(2,6-dichlorophenyl)-4-[2-(3-fluorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 167760406 |
| Molecular Formula | C18H19Cl2FN2 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4-[2-(3-fluorophenyl)ethyl]piperazine |
| SMILES | Fc1cccc(CCN2CCN(c3c(Cl)cccc3Cl)CC2)c1 |
| InChI | InChI=1S/C18H19Cl2FN2/c19-16-5-2-6-17(20)18(16)23-11-9-22(10-12-23)8-7-14-3-1-4-15(21)13-14/h1-6,13H,7-12H2 |
| InChIKey | AMJBXZOXZOTMAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |