C29H26Cl3N5O4 — CID 167761398
2-benzyl-5-methyl-4-[3-[1-(2,4,5-trichlorophenyl)triazol-4-yl]morpholine-4-carbonyl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 167761398) has the molecular formula C29H26Cl3N5O4 and a molecular weight of 614.92 g/mol. Its IUPAC name is 2-benzyl-5-methyl-4-[3-[1-(2,4,5-trichlorophenyl)triazol-4-yl]morpholine-4-carbonyl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-5-methyl-4-[3-[1-(2,4,5-trichlorophenyl)triazol-4-yl]morpholine-4-carbonyl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 167761398 |
| Molecular Formula | C29H26Cl3N5O4 |
| Molecular Weight | 614.92 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | 2-benzyl-5-methyl-4-[3-[1-(2,4,5-trichlorophenyl)triazol-4-yl]morpholine-4-carbonyl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1C=CC2C(=O)N(Cc3ccccc3)C(=O)C2C1C(=O)N1CCOCC1c1cn(-c2cc(Cl)c(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C29H26Cl3N5O4/c1-16-7-8-18-26(29(40)36(27(18)38)13-17-5-3-2-4-6-17)25(16)28(39)35-9-10-41-15-24(35)22-14-37(34-33-22)23-12-20(31)19(30)11-21(23)32/h2-8,11-12,14,16,18,24-26H,9-10,13,15H2,1H3 |
| InChIKey | HJTLRLOQUSJWNW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|