C17H17F3N4O3 — CID 167761431
6-[3-[(dimethylamino)methyl]phenyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 167761431) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is 6-[3-[(dimethylamino)methyl]phenyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[3-[(dimethylamino)methyl]phenyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167761431 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-[3-[(dimethylamino)methyl]phenyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)Cc1cccc(-c2cc3c(=O)[nH]cnn3c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16N4O.C2HF3O2/c1-18(2)8-11-4-3-5-12(6-11)13-7-14-15(20)16-10-17-19(14)9-13;3-2(4,5)1(6)7/h3-7,9-10H,8H2,1-2H3,(H,16,17,20);(H,6,7) |
| InChIKey | MJFBQPAQVLLVPM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |