C21H25N3O2 — CID 167761492
N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-phenylmethoxypyridine-2-carboxamide (PubChem CID 167761492) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-phenylmethoxypyridine-2-carboxamide.
| Compound Name | N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-phenylmethoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 167761492 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-phenylmethoxypyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(OCc2ccccc2)ccn1)C1=CCN(C)CC1 |
| InChI | InChI=1S/C21H25N3O2/c1-16(18-9-12-24(2)13-10-18)23-21(25)20-14-19(8-11-22-20)26-15-17-6-4-3-5-7-17/h3-9,11,14,16H,10,12-13,15H2,1-2H3,(H,23,25) |
| InChIKey | QLSZHDJCWJGKAP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|