About 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione
3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 167761528) has the molecular formula C14H12F2N2O2
and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
| PubChem CID | 167761528 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(N2CCC(c3cc(F)cc(F)c3)C2)c(=O)c1=O |
| InChI | InChI=1S/C14H12F2N2O2/c15-9-3-8(4-10(16)5-9)7-1-2-18(6-7)12-11(17)13(19)14(12)20/h3-5,7H,1-2,6,17H2 |
| InChIKey | AVDOHNDAILSIFF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione (CID 167761528) is 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione is Nc1c(N2CCC(c3cc(F)cc(F)c3)C2)c(=O)c1=O.
What is the InChIKey of 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione?
The InChIKey is AVDOHNDAILSIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O2/c15-9-3-8(4-10(16)5-9)7-1-2-18(6-7)12-11(17)13(19)14(12)20/h3-5,7H,1-2,6,17H2.
What are the key properties of 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione?
3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione has a molecular weight of 278.26 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[3-(3,5-difluorophenyl)pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 167761528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).