C21H24N4O — CID 167761587
piperidin-3-yl-[4-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methanol (PubChem CID 167761587) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is piperidin-3-yl-[4-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methanol.
| Compound Name | piperidin-3-yl-[4-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 167761587 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | piperidin-3-yl-[4-[4-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]methanol |
| SMILES | OC(c1ccc(-c2ccc(Cn3cncn3)cc2)cc1)C1CCCNC1 |
| InChI | InChI=1S/C21H24N4O/c26-21(20-2-1-11-22-12-20)19-9-7-18(8-10-19)17-5-3-16(4-6-17)13-25-15-23-14-24-25/h3-10,14-15,20-22,26H,1-2,11-13H2 |
| InChIKey | ATHIQSSSXUQLFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |