About ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate
ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate (PubChem CID 167762187) has the molecular formula C22H21BrN4O3
and a molecular weight of 469.34 g/mol. Its IUPAC name is ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate |
| PubChem CID | 167762187 |
| Molecular Formula | C22H21BrN4O3 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccccc2)c1NC(=O)[C@@H]1C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN4O3/c1-2-30-22(29)19-20(27(26-25-19)13-14-6-4-3-5-7-14)24-21(28)18-12-17(18)15-8-10-16(23)11-9-15/h3-11,17-18H,2,12-13H2,1H3,(H,24,28)/t17-,18+/m0/s1 |
| InChIKey | PJKROXOKVHVHRN-ZWKOTPCHSA-N |
| XLogP | 4.01 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate?
The IUPAC name of ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate (CID 167762187) is ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate?
The canonical SMILES for ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate is CCOC(=O)c1nnn(Cc2ccccc2)c1NC(=O)[C@@H]1C[C@H]1c1ccc(Br)cc1.
What is the InChIKey of ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate?
The InChIKey is PJKROXOKVHVHRN-ZWKOTPCHSA-N. The full InChI is InChI=1S/C22H21BrN4O3/c1-2-30-22(29)19-20(27(26-25-19)13-14-6-4-3-5-7-14)24-21(28)18-12-17(18)15-8-10-16(23)11-9-15/h3-11,17-18H,2,12-13H2,1H3,(H,24,28)/t17-,18+/m0/s1.
What are the key properties of ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate?
ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate has a molecular weight of 469.34 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-5-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]amino]triazole-4-carboxylate is sourced from PubChem (CID 167762187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).