C18H18FN3O3 — CID 167762202
1-(4-fluorophenyl)-3-[3-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 167762202) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(4-fluorophenyl)-3-[3-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167762202 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-(3-methyl-1,2-oxazol-5-yl)pyrrolidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C2CCN(C3CC(=O)N(c4ccc(F)cc4)C3=O)C2)on1 |
| InChI | InChI=1S/C18H18FN3O3/c1-11-8-16(25-20-11)12-6-7-21(10-12)15-9-17(23)22(18(15)24)14-4-2-13(19)3-5-14/h2-5,8,12,15H,6-7,9-10H2,1H3 |
| InChIKey | YYYBJBWMERMIPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|