C21H18N2O3 — CID 167762508
2-[[[5-(4-methylphenyl)pyridine-3-carbonyl]amino]methyl]benzoic acid (PubChem CID 167762508) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[[[5-(4-methylphenyl)pyridine-3-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 2-[[[5-(4-methylphenyl)pyridine-3-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 167762508 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[[[5-(4-methylphenyl)pyridine-3-carbonyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc(-c2cncc(C(=O)NCc3ccccc3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C21H18N2O3/c1-14-6-8-15(9-7-14)17-10-18(12-22-11-17)20(24)23-13-16-4-2-3-5-19(16)21(25)26/h2-12H,13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | PHHGTOAMBRQJQH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |